C27H23F8N3O2 — CID 174631432
N-(2-amino-2-oxoethyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-3-(2-methylanilino)benzamide (PubChem CID 174631432) has the molecular formula C27H23F8N3O2 and a molecular weight of 573.48 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-3-(2-methylanilino)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-3-(2-methylanilino)benzamide |
|---|---|
| PubChem CID | 174631432 |
| Molecular Formula | C27H23F8N3O2 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-3-(2-methylanilino)benzamide |
| SMILES | Cc1ccccc1Nc1cccc(C(=O)N(CC(N)=O)c2c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C)c1F |
| InChI | InChI=1S/C27H23F8N3O2/c1-14-7-4-5-9-19(14)37-20-10-6-8-18(22(20)28)24(40)38(13-21(36)39)23-15(2)11-17(12-16(23)3)25(29,26(30,31)32)27(33,34)35/h4-12,37H,13H2,1-3H3,(H2,36,39) |
| InChIKey | HOYKRKRNLPREJG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |