C32H39N3O7 — CID 67571780
2-[N-(2-acetyloxyethyl)-3-benzamidoanilino]ethyl acetate;methyl 3-(N-methylanilino)propanoate (PubChem CID 67571780) has the molecular formula C32H39N3O7 and a molecular weight of 577.68 g/mol. Its IUPAC name is 2-[N-(2-acetyloxyethyl)-3-benzamidoanilino]ethyl acetate;methyl 3-(N-methylanilino)propanoate.
| Compound Name | 2-[N-(2-acetyloxyethyl)-3-benzamidoanilino]ethyl acetate;methyl 3-(N-methylanilino)propanoate |
|---|---|
| PubChem CID | 67571780 |
| Molecular Formula | C32H39N3O7 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 2-[N-(2-acetyloxyethyl)-3-benzamidoanilino]ethyl acetate;methyl 3-(N-methylanilino)propanoate |
| SMILES | CC(=O)OCCN(CCOC(C)=O)c1cccc(NC(=O)c2ccccc2)c1.COC(=O)CCN(C)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O5.C11H15NO2/c1-16(24)27-13-11-23(12-14-28-17(2)25)20-10-6-9-19(15-20)22-21(26)18-7-4-3-5-8-18;1-12(9-8-11(13)14-2)10-6-4-3-5-7-10/h3-10,15H,11-14H2,1-2H3,(H,22,26);3-7H,8-9H2,1-2H3 |
| InChIKey | RDERHKCNSHTRJS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|