C26H15BrF11NO2 — CID 58298663
N-[3-[2-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-methylbenzamide (PubChem CID 58298663) has the molecular formula C26H15BrF11NO2 and a molecular weight of 662.29 g/mol. Its IUPAC name is N-[3-[2-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-methylbenzamide.
| Compound Name | N-[3-[2-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58298663 |
| Molecular Formula | C26H15BrF11NO2 |
| Molecular Weight | 662.29 g/mol |
| Exact Mass | 661.01 |
| IUPAC Name | N-[3-[2-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)c1cccc(C(=O)Cc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C26H15BrF11NO2/c1-39(22(41)13-6-3-2-4-7-13)19-9-5-8-15(21(19)28)20(40)12-16-17(24(30,31)32)10-14(11-18(16)27)23(29,25(33,34)35)26(36,37)38/h2-11H,12H2,1H3 |
| InChIKey | VIYSOZLDNIHHEW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.29 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |