C24H13BrF11N3O3 — CID 87289168
N-[3-[bromo-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-methyl-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 87289168) has the molecular formula C24H13BrF11N3O3 and a molecular weight of 680.27 g/mol. Its IUPAC name is N-[3-[bromo-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-methyl-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[bromo-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-methyl-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 87289168 |
| Molecular Formula | C24H13BrF11N3O3 |
| Molecular Weight | 680.27 g/mol |
| Exact Mass | 679.00 |
| IUPAC Name | N-[3-[bromo-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-methyl-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CN(C(=O)c1cc[n+]([O-])cc1)c1cccc(C(=O)N(Br)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C24H13BrF11N3O3/c1-37(19(40)12-7-9-38(42)10-8-12)17-4-2-3-14(18(17)26)20(41)39(25)16-6-5-13(11-15(16)22(28,29)30)21(27,23(31,32)33)24(34,35)36/h2-11H,1H3 |
| InChIKey | ZGOZNBTYOKRZES-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.27 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|