C25H12Br2F12N2O2 — CID 87289064
N-bromo-N-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-3-[(2,6-difluorobenzoyl)-methylamino]-2-fluorobenzamide (PubChem CID 87289064) has the molecular formula C25H12Br2F12N2O2 and a molecular weight of 760.17 g/mol. Its IUPAC name is N-bromo-N-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-3-[(2,6-difluorobenzoyl)-methylamino]-2-fluorobenzamide.
| Compound Name | N-bromo-N-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-3-[(2,6-difluorobenzoyl)-methylamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 87289064 |
| Molecular Formula | C25H12Br2F12N2O2 |
| Molecular Weight | 760.17 g/mol |
| Exact Mass | 757.91 |
| IUPAC Name | N-bromo-N-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-3-[(2,6-difluorobenzoyl)-methylamino]-2-fluorobenzamide |
| SMILES | CN(C(=O)c1c(F)cccc1F)c1cccc(C(=O)N(Br)c2ccc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2Br)c1F |
| InChI | InChI=1S/C25H12Br2F12N2O2/c1-40(21(43)18-14(28)5-3-6-15(18)29)17-7-2-4-12(19(17)30)20(42)41(27)16-9-8-11(10-13(16)26)22(31,24(34,35)36)23(32,33)25(37,38)39/h2-10H,1H3 |
| InChIKey | YUOPTDLVDQNSFG-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.17 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|