C26H14ClF10N3O2 — CID 87289141
N-chloro-3-[(4-cyanobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 87289141) has the molecular formula C26H14ClF10N3O2 and a molecular weight of 625.85 g/mol. Its IUPAC name is N-chloro-3-[(4-cyanobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-chloro-3-[(4-cyanobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87289141 |
| Molecular Formula | C26H14ClF10N3O2 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | N-chloro-3-[(4-cyanobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN(C(=O)c1ccc(C#N)cc1)c1cccc(C(=O)N(Cl)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C26H14ClF10N3O2/c1-39(21(41)15-7-5-14(13-38)6-8-15)18-4-2-3-16(11-18)22(42)40(27)20-10-9-17(12-19(20)24(29,30)31)23(28,25(32,33)34)26(35,36)37/h2-12H,1H3 |
| InChIKey | NOASUVZHWAYZNI-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|