C29H22ClF7N2O3 — CID 159756517
N-[3-[2-[2-chloro-6-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-methoxyphenyl]-4-cyano-N-methylbenzamide (PubChem CID 159756517) has the molecular formula C29H22ClF7N2O3 and a molecular weight of 614.95 g/mol. Its IUPAC name is N-[3-[2-[2-chloro-6-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-methoxyphenyl]-4-cyano-N-methylbenzamide.
| Compound Name | N-[3-[2-[2-chloro-6-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-methoxyphenyl]-4-cyano-N-methylbenzamide |
|---|---|
| PubChem CID | 159756517 |
| Molecular Formula | C29H22ClF7N2O3 |
| Molecular Weight | 614.95 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | N-[3-[2-[2-chloro-6-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-methoxyphenyl]-4-cyano-N-methylbenzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(Cl)c1CC(=O)c1cccc(N(C)C(=O)c2ccc(C#N)cc2)c1OC |
| InChI | InChI=1S/C29H22ClF7N2O3/c1-4-17-12-19(27(31,28(32,33)34)29(35,36)37)13-22(30)21(17)14-24(40)20-6-5-7-23(25(20)42-3)39(2)26(41)18-10-8-16(15-38)9-11-18/h5-13H,4,14H2,1-3H3 |
| InChIKey | NEIHHMUNEYEXPU-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.95 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |