C31H27F7N2O3 — CID 161195509
4-cyano-N-ethyl-N-[3-[2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]acetyl]-2-methoxyphenyl]benzamide (PubChem CID 161195509) has the molecular formula C31H27F7N2O3 and a molecular weight of 608.55 g/mol. Its IUPAC name is 4-cyano-N-ethyl-N-[3-[2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]acetyl]-2-methoxyphenyl]benzamide.
| Compound Name | 4-cyano-N-ethyl-N-[3-[2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]acetyl]-2-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 161195509 |
| Molecular Formula | C31H27F7N2O3 |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 4-cyano-N-ethyl-N-[3-[2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]acetyl]-2-methoxyphenyl]benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1CC(=O)c1cccc(N(CC)C(=O)c2ccc(C#N)cc2)c1OC |
| InChI | InChI=1S/C31H27F7N2O3/c1-5-20-15-22(29(32,30(33,34)35)31(36,37)38)14-18(3)24(20)16-26(41)23-8-7-9-25(27(23)43-4)40(6-2)28(42)21-12-10-19(17-39)11-13-21/h7-15H,5-6,16H2,1-4H3 |
| InChIKey | UUHCODGCOOXKQV-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |