C28H20ClF10NO3 — CID 149476601
N-[3-[2-[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-N-ethyl-2-methylbenzamide (PubChem CID 149476601) has the molecular formula C28H20ClF10NO3 and a molecular weight of 643.91 g/mol. Its IUPAC name is N-[3-[2-[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-N-ethyl-2-methylbenzamide.
| Compound Name | N-[3-[2-[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-N-ethyl-2-methylbenzamide |
|---|---|
| PubChem CID | 149476601 |
| Molecular Formula | C28H20ClF10NO3 |
| Molecular Weight | 643.91 g/mol |
| Exact Mass | 643.10 |
| IUPAC Name | N-[3-[2-[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]acetyl]-2-fluorophenyl]-N-ethyl-2-methylbenzamide |
| SMILES | CCN(C(=O)c1ccccc1C)c1cccc(C(=O)Cc2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1F |
| InChI | InChI=1S/C28H20ClF10NO3/c1-3-40(24(42)16-8-5-4-7-14(16)2)20-10-6-9-17(23(20)30)21(41)13-18-19(29)11-15(12-22(18)43-25(31)32)26(33,27(34,35)36)28(37,38)39/h4-12,25H,3,13H2,1-2H3 |
| InChIKey | ZCKLNUOKTZIXRW-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.91 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |