C26H20BrClF8N3O4+ — CID 140761663
N-[3-[[2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)phenyl]carbamoyl]-2-methoxyphenyl]-N-ethylpyridin-1-ium-4-carboxamide (PubChem CID 140761663) has the molecular formula C26H20BrClF8N3O4+ and a molecular weight of 705.80 g/mol. Its IUPAC name is N-[3-[[2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)phenyl]carbamoyl]-2-methoxyphenyl]-N-ethylpyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[[2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)phenyl]carbamoyl]-2-methoxyphenyl]-N-ethylpyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 140761663 |
| Molecular Formula | C26H20BrClF8N3O4+ |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 704.02 |
| IUPAC Name | N-[3-[[2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)phenyl]carbamoyl]-2-methoxyphenyl]-N-ethylpyridin-1-ium-4-carboxamide |
| SMILES | CCN(C(=O)c1cc[nH+]cc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)Cl)cc2OC(F)F)c1OC |
| InChI | InChI=1S/C26H19BrClF8N3O4/c1-3-39(22(41)13-7-9-37-10-8-13)17-6-4-5-15(20(17)42-2)21(40)38-19-16(27)11-14(12-18(19)43-23(29)30)24(31,25(28,32)33)26(34,35)36/h4-12,23H,3H2,1-2H3,(H,38,40)/p+1 |
| InChIKey | JBVPYOWVFQLARV-UHFFFAOYSA-O |
| XLogP | 7.35 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|