C29H22F9N3O4 — CID 154622946
3-[(4-cyanobenzoyl)-ethylamino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2-methoxybenzamide (PubChem CID 154622946) has the molecular formula C29H22F9N3O4 and a molecular weight of 647.49 g/mol. Its IUPAC name is 3-[(4-cyanobenzoyl)-ethylamino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2-methoxybenzamide.
| Compound Name | 3-[(4-cyanobenzoyl)-ethylamino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 154622946 |
| Molecular Formula | C29H22F9N3O4 |
| Molecular Weight | 647.49 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | 3-[(4-cyanobenzoyl)-ethylamino]-N-[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2-methoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(C#N)cc1)c1cccc(C(=O)Nc2c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1OC |
| InChI | InChI=1S/C29H22F9N3O4/c1-4-41(25(43)17-10-8-16(14-39)9-11-17)20-7-5-6-19(23(20)44-3)24(42)40-22-15(2)12-18(13-21(22)45-26(30)31)27(32,28(33,34)35)29(36,37)38/h5-13,26H,4H2,1-3H3,(H,40,42) |
| InChIKey | FOOUICDYIVWUGF-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |