C25H20Br2F7N3O3 — CID 134388623
N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexa-2,4-dien-1-yl]-methylcarbamoyl]-2-methoxyphenyl]-N-methylpyridine-4-carboxamide (PubChem CID 134388623) has the molecular formula C25H20Br2F7N3O3 and a molecular weight of 703.25 g/mol. Its IUPAC name is N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexa-2,4-dien-1-yl]-methylcarbamoyl]-2-methoxyphenyl]-N-methylpyridine-4-carboxamide.
| Compound Name | N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexa-2,4-dien-1-yl]-methylcarbamoyl]-2-methoxyphenyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 134388623 |
| Molecular Formula | C25H20Br2F7N3O3 |
| Molecular Weight | 703.25 g/mol |
| Exact Mass | 700.98 |
| IUPAC Name | N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexa-2,4-dien-1-yl]-methylcarbamoyl]-2-methoxyphenyl]-N-methylpyridine-4-carboxamide |
| SMILES | COc1c(C(=O)N(C)C2C(Br)=CC(C(F)(C(F)(F)F)C(F)(F)F)=CC2Br)cccc1N(C)C(=O)c1ccncc1 |
| InChI | InChI=1S/C25H20Br2F7N3O3/c1-36(21(38)13-7-9-35-10-8-13)18-6-4-5-15(20(18)40-3)22(39)37(2)19-16(26)11-14(12-17(19)27)23(28,24(29,30)31)25(32,33)34/h4-12,16,19H,1-3H3 |
| InChIKey | JKPKCLACBAGCES-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.25 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|