C24H13BrClF10N3O2 — CID 87289015
N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-methylcarbamoyl]phenyl]-2-chloropyridine-3-carboxamide (PubChem CID 87289015) has the molecular formula C24H13BrClF10N3O2 and a molecular weight of 680.72 g/mol. Its IUPAC name is N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-methylcarbamoyl]phenyl]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-methylcarbamoyl]phenyl]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 87289015 |
| Molecular Formula | C24H13BrClF10N3O2 |
| Molecular Weight | 680.72 g/mol |
| Exact Mass | 678.97 |
| IUPAC Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-methylcarbamoyl]phenyl]-2-chloropyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cccc(NC(=O)c2cccnc2Cl)c1)c1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H13BrClF10N3O2/c1-39(20(41)11-4-2-5-13(8-11)38-19(40)14-6-3-7-37-18(14)26)17-15(22(28,29)30)9-12(10-16(17)25)21(27,23(31,32)33)24(34,35)36/h2-10H,1H3,(H,38,40) |
| InChIKey | YCKYUJOQVJGVDY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.72 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|