C23H23F11N4O3 — CID 145167844
acetyl fluoride;N-[4-[amino-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2H-azepin-6-yl]formamide;ethane (PubChem CID 145167844) has the molecular formula C23H23F11N4O3 and a molecular weight of 612.44 g/mol. Its IUPAC name is acetyl fluoride;N-[4-[amino-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2H-azepin-6-yl]formamide;ethane.
| Compound Name | acetyl fluoride;N-[4-[amino-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2H-azepin-6-yl]formamide;ethane |
|---|---|
| PubChem CID | 145167844 |
| Molecular Formula | C23H23F11N4O3 |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | acetyl fluoride;N-[4-[amino-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]carbamoyl]-2H-azepin-6-yl]formamide;ethane |
| SMILES | CC.CC(=O)F.Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1N(N)C(=O)C1=CCN=CC(NC=O)=C1 |
| InChI | InChI=1S/C19H14F10N4O2.C2H3FO.C2H6/c1-9-4-11(16(20,18(24,25)26)19(27,28)29)6-13(17(21,22)23)14(9)33(30)15(35)10-2-3-31-7-12(5-10)32-8-34;1-2(3)4;1-2/h2,4-8H,3,30H2,1H3,(H,32,34);1H3;1-2H3 |
| InChIKey | JLUVJHBHOSWENF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|