C12H7F10NO2 — CID 174958340
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-methyl-6-(trifluoromethyl)benzamide (PubChem CID 174958340) has the molecular formula C12H7F10NO2 and a molecular weight of 387.17 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-methyl-6-(trifluoromethyl)benzamide.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-methyl-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174958340 |
| Molecular Formula | C12H7F10NO2 |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-methyl-6-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1C(=O)NO |
| InChI | InChI=1S/C12H7F10NO2/c1-4-2-5(9(13,11(17,18)19)12(20,21)22)3-6(10(14,15)16)7(4)8(24)23-25/h2-3,25H,1H3,(H,23,24) |
| InChIKey | KIELSQMNLREOGN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|