C13H6F10 — CID 118064857
2-ethynyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-3-(trifluoromethyl)benzene (PubChem CID 118064857) has the molecular formula C13H6F10 and a molecular weight of 352.17 g/mol. Its IUPAC name is 2-ethynyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-3-(trifluoromethyl)benzene.
| Compound Name | 2-ethynyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118064857 |
| Molecular Formula | C13H6F10 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-ethynyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-3-(trifluoromethyl)benzene |
| SMILES | C#Cc1c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H6F10/c1-3-8-6(2)4-7(5-9(8)11(15,16)17)10(14,12(18,19)20)13(21,22)23/h1,4-5H,2H3 |
| InChIKey | VCHQBOHDGXEESG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|