C12H9F9O — CID 87143094
2,6-dimethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenol (PubChem CID 87143094) has the molecular formula C12H9F9O and a molecular weight of 340.19 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenol.
| Compound Name | 2,6-dimethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenol |
|---|---|
| PubChem CID | 87143094 |
| Molecular Formula | C12H9F9O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2,6-dimethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenol |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C12H9F9O/c1-5-3-7(4-6(2)8(5)22)9(13,11(16,17)18)10(14,15)12(19,20)21/h3-4,22H,1-2H3 |
| InChIKey | QWZMGKCMIIGRKD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|