C19H18F6O3 — CID 145189895
4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(hydroxymethyl)-5-methylphenyl]propan-2-yl]-2,6-dimethylphenol (PubChem CID 145189895) has the molecular formula C19H18F6O3 and a molecular weight of 408.34 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(hydroxymethyl)-5-methylphenyl]propan-2-yl]-2,6-dimethylphenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(hydroxymethyl)-5-methylphenyl]propan-2-yl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 145189895 |
| Molecular Formula | C19H18F6O3 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(hydroxymethyl)-5-methylphenyl]propan-2-yl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(c2cc(C)c(O)c(CO)c2)(C(F)(F)F)C(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C19H18F6O3/c1-9-4-13(5-10(2)15(9)27)17(18(20,21)22,19(23,24)25)14-6-11(3)16(28)12(7-14)8-26/h4-7,26-28H,8H2,1-3H3 |
| InChIKey | PAZLCUUYOCOZBY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |