C13H7BrCl3F9O — CID 159128030
2-bromo-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-3-(2,2,2-trichloroethyl)phenol (PubChem CID 159128030) has the molecular formula C13H7BrCl3F9O and a molecular weight of 536.44 g/mol. Its IUPAC name is 2-bromo-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-3-(2,2,2-trichloroethyl)phenol.
| Compound Name | 2-bromo-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-3-(2,2,2-trichloroethyl)phenol |
|---|---|
| PubChem CID | 159128030 |
| Molecular Formula | C13H7BrCl3F9O |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 533.86 |
| IUPAC Name | 2-bromo-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-3-(2,2,2-trichloroethyl)phenol |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c(CC(Cl)(Cl)Cl)c(Br)c1O |
| InChI | InChI=1S/C13H7BrCl3F9O/c1-4-2-6(5(3-9(15,16)17)7(14)8(4)27)10(18,12(21,22)23)11(19,20)13(24,25)26/h2,27H,3H2,1H3 |
| InChIKey | KGNHCNRTNPYYDQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|