C11H10F6O2 — CID 118535872
2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,6-dimethylphenol (PubChem CID 118535872) has the molecular formula C11H10F6O2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,6-dimethylphenol.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,6-dimethylphenol |
|---|---|
| PubChem CID | 118535872 |
| Molecular Formula | C11H10F6O2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6O2/c1-5-3-6(2)8(18)7(4-5)9(19,10(12,13)14)11(15,16)17/h3-4,18-19H,1-2H3 |
| InChIKey | KRDAZARVKGHHDN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |