C9H12O — CID 10698
2,4,6-trimethylphenol (PubChem CID 10698) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 2,4,6-trimethylphenol.
| Compound Name | 2,4,6-trimethylphenol |
|---|---|
| PubChem CID | 10698 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2,4,6-trimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C9H12O/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3 |
| InChIKey | BPRYUXCVCCNUFE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |