C24H22F4O2 — CID 141280723
2,6-dimethyl-4-[2,2,2-trifluoro-1-(2-fluorophenyl)-1-(4-hydroxy-3,5-dimethylphenyl)ethyl]phenol (PubChem CID 141280723) has the molecular formula C24H22F4O2 and a molecular weight of 418.43 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2,2,2-trifluoro-1-(2-fluorophenyl)-1-(4-hydroxy-3,5-dimethylphenyl)ethyl]phenol.
| Compound Name | 2,6-dimethyl-4-[2,2,2-trifluoro-1-(2-fluorophenyl)-1-(4-hydroxy-3,5-dimethylphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 141280723 |
| Molecular Formula | C24H22F4O2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2,6-dimethyl-4-[2,2,2-trifluoro-1-(2-fluorophenyl)-1-(4-hydroxy-3,5-dimethylphenyl)ethyl]phenol |
| SMILES | Cc1cc(C(c2cc(C)c(O)c(C)c2)(c2ccccc2F)C(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C24H22F4O2/c1-13-9-17(10-14(2)21(13)29)23(24(26,27)28,19-7-5-6-8-20(19)25)18-11-15(3)22(30)16(4)12-18/h5-12,29-30H,1-4H3 |
| InChIKey | IPEUABHAWXNETH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|