C16H12F6O — CID 162511534
2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-methylphenyl)propan-1-ol (PubChem CID 162511534) has the molecular formula C16H12F6O and a molecular weight of 334.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-methylphenyl)propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 162511534 |
| Molecular Formula | C16H12F6O |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-methylphenyl)propan-1-ol |
| SMILES | Cc1cccc(C(O)(c2ccccc2F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6O/c1-10-5-4-6-11(9-10)14(23,15(18,19)16(20,21)22)12-7-2-3-8-13(12)17/h2-9,23H,1H3 |
| InChIKey | KVODITMXMJRAEW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|