C15H9F7O — CID 162511741
2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-fluorophenyl)propan-1-ol (PubChem CID 162511741) has the molecular formula C15H9F7O and a molecular weight of 338.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-fluorophenyl)propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 162511741 |
| Molecular Formula | C15H9F7O |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2-fluorophenyl)-1-(3-fluorophenyl)propan-1-ol |
| SMILES | OC(c1cccc(F)c1)(c1ccccc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H9F7O/c16-10-5-3-4-9(8-10)13(23,14(18,19)15(20,21)22)11-6-1-2-7-12(11)17/h1-8,23H |
| InChIKey | SSLABCWOOKUBCS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|