C13H16F4O — CID 173133106
1,1,1-trifluoro-4-(3-fluorophenyl)-2,4-dimethylpentan-2-ol (PubChem CID 173133106) has the molecular formula C13H16F4O and a molecular weight of 264.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(3-fluorophenyl)-2,4-dimethylpentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(3-fluorophenyl)-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 173133106 |
| Molecular Formula | C13H16F4O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1,1,1-trifluoro-4-(3-fluorophenyl)-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)(CC(C)(O)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16F4O/c1-11(2,8-12(3,18)13(15,16)17)9-5-4-6-10(14)7-9/h4-7,18H,8H2,1-3H3 |
| InChIKey | ONYUARAXKIORFO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |