C11H13BrFNO — CID 115194299
N-[2-(3-fluorophenyl)-2-methylpropyl]carbamoyl bromide (PubChem CID 115194299) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-methylpropyl]carbamoyl bromide.
| Compound Name | N-[2-(3-fluorophenyl)-2-methylpropyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115194299 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-methylpropyl]carbamoyl bromide |
| SMILES | CC(C)(CNC(=O)Br)c1cccc(F)c1 |
| InChI | InChI=1S/C11H13BrFNO/c1-11(2,7-14-10(12)15)8-4-3-5-9(13)6-8/h3-6H,7H2,1-2H3,(H,14,15) |
| InChIKey | AGCMDINQSZMQFE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|