C12H16BrNO — CID 115194297
N-[2-methyl-2-(3-methylphenyl)propyl]carbamoyl bromide (PubChem CID 115194297) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is N-[2-methyl-2-(3-methylphenyl)propyl]carbamoyl bromide.
| Compound Name | N-[2-methyl-2-(3-methylphenyl)propyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115194297 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-[2-methyl-2-(3-methylphenyl)propyl]carbamoyl bromide |
| SMILES | Cc1cccc(C(C)(C)CNC(=O)Br)c1 |
| InChI | InChI=1S/C12H16BrNO/c1-9-5-4-6-10(7-9)12(2,3)8-14-11(13)15/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | PWIRBXUDFXQRDW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|