C14H20BrNO — CID 115194226
N-[2-methyl-2-(2,4,6-trimethylphenyl)propyl]carbamoyl bromide (PubChem CID 115194226) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-[2-methyl-2-(2,4,6-trimethylphenyl)propyl]carbamoyl bromide.
| Compound Name | N-[2-methyl-2-(2,4,6-trimethylphenyl)propyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115194226 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[2-methyl-2-(2,4,6-trimethylphenyl)propyl]carbamoyl bromide |
| SMILES | Cc1cc(C)c(C(C)(C)CNC(=O)Br)c(C)c1 |
| InChI | InChI=1S/C14H20BrNO/c1-9-6-10(2)12(11(3)7-9)14(4,5)8-16-13(15)17/h6-7H,8H2,1-5H3,(H,16,17) |
| InChIKey | VTUNFJHHQHAVBP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|