C16H27ClN2O2 — CID 119757019
2-(2-methoxyethylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]acetamide;hydrochloride (PubChem CID 119757019) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119757019 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCC(C)(C)c1cccc(C)c1.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-13-6-5-7-14(10-13)16(2,3)12-18-15(19)11-17-8-9-20-4;/h5-7,10,17H,8-9,11-12H2,1-4H3,(H,18,19);1H |
| InChIKey | WVIWEFLBQRDAIQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|