C11H22N2O4 — CID 119789402
methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-2,2-dimethylpropanoate (PubChem CID 119789402) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 119789402 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl 3-[[2-(2-methoxyethylamino)acetyl]amino]-2,2-dimethylpropanoate |
| SMILES | COCCNCC(=O)NCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,10(15)17-4)8-13-9(14)7-12-5-6-16-3/h12H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | DNRBBEGJMITREV-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|