C12H27ClN2O3 — CID 119803026
N-(4-hydroxy-2,2-dimethylpentyl)-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119803026) has the molecular formula C12H27ClN2O3 and a molecular weight of 282.81 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119803026 |
| Molecular Formula | C12H27ClN2O3 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCC(C)(C)CC(C)O.Cl |
| InChI | InChI=1S/C12H26N2O3.ClH/c1-10(15)7-12(2,3)9-14-11(16)8-13-5-6-17-4;/h10,13,15H,5-9H2,1-4H3,(H,14,16);1H |
| InChIKey | SDZGPNNWWKPSDR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|