C28H24F3O2P — CID 177441543
4-(1-diphenylphosphoryl-2,2,2-trifluoro-1-phenylethyl)-2,6-dimethylphenol (PubChem CID 177441543) has the molecular formula C28H24F3O2P and a molecular weight of 480.47 g/mol. Its IUPAC name is 4-(1-diphenylphosphoryl-2,2,2-trifluoro-1-phenylethyl)-2,6-dimethylphenol.
| Compound Name | 4-(1-diphenylphosphoryl-2,2,2-trifluoro-1-phenylethyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 177441543 |
| Molecular Formula | C28H24F3O2P |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-(1-diphenylphosphoryl-2,2,2-trifluoro-1-phenylethyl)-2,6-dimethylphenol |
| SMILES | Cc1cc(C(c2ccccc2)(C(F)(F)F)P(=O)(c2ccccc2)c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C28H24F3O2P/c1-20-18-23(19-21(2)26(20)32)27(28(29,30)31,22-12-6-3-7-13-22)34(33,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19,32H,1-2H3 |
| InChIKey | FNBMUMWNUOOYMZ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|