C26H24O6P2 — CID 23199837
(1,1,2,2-tetraphenyl-2-phosphonoethyl)phosphonic acid (PubChem CID 23199837) has the molecular formula C26H24O6P2 and a molecular weight of 494.42 g/mol. Its IUPAC name is (1,1,2,2-tetraphenyl-2-phosphonoethyl)phosphonic acid.
| Compound Name | (1,1,2,2-tetraphenyl-2-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 23199837 |
| Molecular Formula | C26H24O6P2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (1,1,2,2-tetraphenyl-2-phosphonoethyl)phosphonic acid |
| SMILES | O=P(O)(O)C(c1ccccc1)(c1ccccc1)C(c1ccccc1)(c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C26H24O6P2/c27-33(28,29)25(21-13-5-1-6-14-21,22-15-7-2-8-16-22)26(34(30,31)32,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | HVTLRJILBVDLNE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|