C11H19NO4P+ — CID 70288650
(2-hydroxy-2-phenyl-2-phosphonoethyl)-trimethylazanium (PubChem CID 70288650) has the molecular formula C11H19NO4P+ and a molecular weight of 260.25 g/mol. Its IUPAC name is (2-hydroxy-2-phenyl-2-phosphonoethyl)-trimethylazanium.
| Compound Name | (2-hydroxy-2-phenyl-2-phosphonoethyl)-trimethylazanium |
|---|---|
| PubChem CID | 70288650 |
| Molecular Formula | C11H19NO4P+ |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2-hydroxy-2-phenyl-2-phosphonoethyl)-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)(c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C11H18NO4P/c1-12(2,3)9-11(13,17(14,15)16)10-7-5-4-6-8-10/h4-8,13H,9H2,1-3H3,(H-,14,15,16)/p+1 |
| InChIKey | DCUUZAPKZDWFQY-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|