C8H12NaO7P2 — CID 6331790
CID 6331790 (PubChem CID 6331790) has the molecular formula C8H12NaO7P2 and a molecular weight of 305.12 g/mol.
| Compound Name | CID 6331790 |
|---|---|
| PubChem CID | 6331790 |
| Molecular Formula | C8H12NaO7P2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | — |
| SMILES | O=P(O)(O)C(O)(Cc1ccccc1)P(=O)(O)O.[Na] |
| InChI | InChI=1S/C8H12O7P2.Na/c9-8(16(10,11)12,17(13,14)15)6-7-4-2-1-3-5-7;/h1-5,9H,6H2,(H2,10,11,12)(H2,13,14,15); |
| InChIKey | QVYSDGPPFBHTFA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|