C12H21O7P2S+ — CID 23730129
(3-hydroxy-3,3-diphosphonopropyl)-methyl-(2-phenylethyl)sulfanium (PubChem CID 23730129) has the molecular formula C12H21O7P2S+ and a molecular weight of 371.31 g/mol. Its IUPAC name is (3-hydroxy-3,3-diphosphonopropyl)-methyl-(2-phenylethyl)sulfanium.
| Compound Name | (3-hydroxy-3,3-diphosphonopropyl)-methyl-(2-phenylethyl)sulfanium |
|---|---|
| PubChem CID | 23730129 |
| Molecular Formula | C12H21O7P2S+ |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (3-hydroxy-3,3-diphosphonopropyl)-methyl-(2-phenylethyl)sulfanium |
| SMILES | C[S+](CCc1ccccc1)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H20O7P2S/c1-22(9-7-11-5-3-2-4-6-11)10-8-12(13,20(14,15)16)21(17,18)19/h2-6,13H,7-10H2,1H3,(H3-,14,15,16,17,18,19)/p+1 |
| InChIKey | ZNWFNTJFZXDICP-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|