C18H27NO7P2 — CID 57256807
[3-ethyl-1-hydroxy-6-phenyl-1-phosphono-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid (PubChem CID 57256807) has the molecular formula C18H27NO7P2 and a molecular weight of 431.36 g/mol. Its IUPAC name is [3-ethyl-1-hydroxy-6-phenyl-1-phosphono-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid.
| Compound Name | [3-ethyl-1-hydroxy-6-phenyl-1-phosphono-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 57256807 |
| Molecular Formula | C18H27NO7P2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [3-ethyl-1-hydroxy-6-phenyl-1-phosphono-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid |
| SMILES | CCC(CCCc1ccccc1)(CC(O)(P(=O)(O)O)P(=O)(O)O)c1ccc[nH]1 |
| InChI | InChI=1S/C18H27NO7P2/c1-2-17(16-11-7-13-19-16,12-6-10-15-8-4-3-5-9-15)14-18(20,27(21,22)23)28(24,25)26/h3-5,7-9,11,13,19-20H,2,6,10,12,14H2,1H3,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | NYYBCBATSYLPNQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|