C17H29O6PS — CID 23374783
1-phenyl-4-phosphonoundecane-4-sulfonic acid (PubChem CID 23374783) has the molecular formula C17H29O6PS and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-phenyl-4-phosphonoundecane-4-sulfonic acid.
| Compound Name | 1-phenyl-4-phosphonoundecane-4-sulfonic acid |
|---|---|
| PubChem CID | 23374783 |
| Molecular Formula | C17H29O6PS |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-phenyl-4-phosphonoundecane-4-sulfonic acid |
| SMILES | CCCCCCCC(CCCc1ccccc1)(P(=O)(O)O)S(=O)(=O)O |
| InChI | InChI=1S/C17H29O6PS/c1-2-3-4-5-9-14-17(24(18,19)20,25(21,22)23)15-10-13-16-11-7-6-8-12-16/h6-8,11-12H,2-5,9-10,13-15H2,1H3,(H2,18,19,20)(H,21,22,23) |
| InChIKey | ZXVVIUWZVMTPIG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|