C27H31NO3 — CID 90731505
3-[4-[4-oxo-1-phenyl-3-(1H-pyrrol-2-yl)octan-3-yl]phenyl]propanoic acid (PubChem CID 90731505) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[4-[4-oxo-1-phenyl-3-(1H-pyrrol-2-yl)octan-3-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-oxo-1-phenyl-3-(1H-pyrrol-2-yl)octan-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90731505 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-[4-[4-oxo-1-phenyl-3-(1H-pyrrol-2-yl)octan-3-yl]phenyl]propanoic acid |
| SMILES | CCCCC(=O)C(CCc1ccccc1)(c1ccc(CCC(=O)O)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C27H31NO3/c1-2-3-11-25(29)27(24-10-7-20-28-24,19-18-21-8-5-4-6-9-21)23-15-12-22(13-16-23)14-17-26(30)31/h4-10,12-13,15-16,20,28H,2-3,11,14,17-19H2,1H3,(H,30,31) |
| InChIKey | PHCRSOKBDFMIEO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |