C12H20O8P2S — CID 23730009
hydroxy-[1-hydroxy-2-[methyl(3-phenoxypropyl)sulfonio]-1-phosphonoethyl]phosphinate (PubChem CID 23730009) has the molecular formula C12H20O8P2S and a molecular weight of 386.30 g/mol. Its IUPAC name is hydroxy-[1-hydroxy-2-[methyl(3-phenoxypropyl)sulfonio]-1-phosphonoethyl]phosphinate.
| Compound Name | hydroxy-[1-hydroxy-2-[methyl(3-phenoxypropyl)sulfonio]-1-phosphonoethyl]phosphinate |
|---|---|
| PubChem CID | 23730009 |
| Molecular Formula | C12H20O8P2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | hydroxy-[1-hydroxy-2-[methyl(3-phenoxypropyl)sulfonio]-1-phosphonoethyl]phosphinate |
| SMILES | C[S+](CCCOc1ccccc1)CC(O)(P(=O)([O-])O)P(=O)(O)O |
| InChI | InChI=1S/C12H20O8P2S/c1-23(9-5-8-20-11-6-3-2-4-7-11)10-12(13,21(14,15)16)22(17,18)19/h2-4,6-7,13H,5,8-10H2,1H3,(H3-,14,15,16,17,18,19) |
| InChIKey | UGVYRAGFCCZORE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|