C13H23NO5P+ — CID 10881215
2-[hydroxy(2-phenoxyethoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 10881215) has the molecular formula C13H23NO5P+ and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[hydroxy(2-phenoxyethoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy(2-phenoxyethoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10881215 |
| Molecular Formula | C13H23NO5P+ |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[hydroxy(2-phenoxyethoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCCOc1ccccc1 |
| InChI | InChI=1S/C13H22NO5P/c1-14(2,3)9-10-18-20(15,16)19-12-11-17-13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3/p+1 |
| InChIKey | ZDINIBUTXZLOHM-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|