C20H28NO6P — CID 68911842
[(2R)-2,3-diphenoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 68911842) has the molecular formula C20H28NO6P and a molecular weight of 409.42 g/mol. Its IUPAC name is [(2R)-2,3-diphenoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-diphenoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 68911842 |
| Molecular Formula | C20H28NO6P |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [(2R)-2,3-diphenoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@@H](COc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C20H28NO6P/c1-21(2,3)14-15-25-28(22,23)26-17-20(27-19-12-8-5-9-13-19)16-24-18-10-6-4-7-11-18/h4-13,20H,14-17H2,1-3H3/t20-/m1/s1 |
| InChIKey | IONQCUNMRFMLJS-HXUWFJFHSA-N |
| XLogP | 2.72 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|