C22H32NO6P — CID 44578062
[2-(naphthalen-1-ylmethoxy)-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 44578062) has the molecular formula C22H32NO6P and a molecular weight of 437.47 g/mol. Its IUPAC name is [2-(naphthalen-1-ylmethoxy)-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-(naphthalen-1-ylmethoxy)-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 44578062 |
| Molecular Formula | C22H32NO6P |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [2-(naphthalen-1-ylmethoxy)-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C=CCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C22H32NO6P/c1-5-14-26-17-21(18-29-30(24,25)28-15-13-23(2,3)4)27-16-20-11-8-10-19-9-6-7-12-22(19)20/h5-12,21H,1,13-18H2,2-4H3 |
| InChIKey | BUEGCUDEOWYNSL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|