C19H33N4O6P — CID 44577660
[3-(benzotriazol-1-ylmethoxy)-2-butoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 44577660) has the molecular formula C19H33N4O6P and a molecular weight of 444.47 g/mol. Its IUPAC name is [3-(benzotriazol-1-ylmethoxy)-2-butoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-(benzotriazol-1-ylmethoxy)-2-butoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 44577660 |
| Molecular Formula | C19H33N4O6P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [3-(benzotriazol-1-ylmethoxy)-2-butoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCOC(COCn1nnc2ccccc21)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C19H33N4O6P/c1-5-6-12-27-17(15-29-30(24,25)28-13-11-23(2,3)4)14-26-16-22-19-10-8-7-9-18(19)20-21-22/h7-10,17H,5-6,11-16H2,1-4H3 |
| InChIKey | AXOPJLHHZCBHNN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|