C11H24NO7P — CID 87170931
[(2R)-2-hydroperoxy-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 87170931) has the molecular formula C11H24NO7P and a molecular weight of 313.29 g/mol. Its IUPAC name is [(2R)-2-hydroperoxy-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-hydroperoxy-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 87170931 |
| Molecular Formula | C11H24NO7P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [(2R)-2-hydroperoxy-3-prop-2-enoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C=CCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OO |
| InChI | InChI=1S/C11H24NO7P/c1-5-7-16-9-11(19-13)10-18-20(14,15)17-8-6-12(2,3)4/h5,11H,1,6-10H2,2-4H3,(H-,13,14,15)/t11-/m1/s1 |
| InChIKey | MUHGHCBNGFIINT-LLVKDONJSA-N |
| XLogP | 0.25 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|