C11H22NO6P — CID 87338155
2-prop-2-enoyloxypropyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 87338155) has the molecular formula C11H22NO6P and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-prop-2-enoyloxypropyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-prop-2-enoyloxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 87338155 |
| Molecular Formula | C11H22NO6P |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-prop-2-enoyloxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C=CC(=O)OC(C)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C11H22NO6P/c1-6-11(13)18-10(2)9-17-19(14,15)16-8-7-12(3,4)5/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | NZLIHSNMFSPPEP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|