C46H92NO8P — CID 177495077
[(2R)-2,3-bis(2,6,10,14-tetramethylpentadecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 177495077) has the molecular formula C46H92NO8P and a molecular weight of 818.21 g/mol. Its IUPAC name is [(2R)-2,3-bis(2,6,10,14-tetramethylpentadecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-bis(2,6,10,14-tetramethylpentadecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 177495077 |
| Molecular Formula | C46H92NO8P |
| Molecular Weight | 818.21 g/mol |
| Exact Mass | 817.66 |
| IUPAC Name | [(2R)-2,3-bis(2,6,10,14-tetramethylpentadecanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C46H92NO8P/c1-36(2)20-14-22-38(5)24-16-26-40(7)28-18-30-42(9)45(48)52-34-44(35-54-56(50,51)53-33-32-47(11,12)13)55-46(49)43(10)31-19-29-41(8)27-17-25-39(6)23-15-21-37(3)4/h36-44H,14-35H2,1-13H3/t38?,39?,40?,41?,42?,43?,44-/m1/s1 |
| InChIKey | LZOXEEGMHZBKGH-MROBFMCTSA-N |
| XLogP | 11.80 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.21 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|