C45H89NO8P- — CID 102215324
2-aminoethyl [(2R)-2,3-bis[[(3S,7R,11R)-3,7,11,15-tetramethylhexadecanoyl]oxy]propyl] phosphate (PubChem CID 102215324) has the molecular formula C45H89NO8P- and a molecular weight of 803.18 g/mol. Its IUPAC name is 2-aminoethyl [(2R)-2,3-bis[[(3S,7R,11R)-3,7,11,15-tetramethylhexadecanoyl]oxy]propyl] phosphate.
| Compound Name | 2-aminoethyl [(2R)-2,3-bis[[(3S,7R,11R)-3,7,11,15-tetramethylhexadecanoyl]oxy]propyl] phosphate |
|---|---|
| PubChem CID | 102215324 |
| Molecular Formula | C45H89NO8P- |
| Molecular Weight | 803.18 g/mol |
| Exact Mass | 802.63 |
| IUPAC Name | 2-aminoethyl [(2R)-2,3-bis[[(3S,7R,11R)-3,7,11,15-tetramethylhexadecanoyl]oxy]propyl] phosphate |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@H](C)CC(=O)OC[C@H](COP(=O)([O-])OCCN)OC(=O)C[C@@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C45H90NO8P/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)31-44(47)51-33-43(34-53-55(49,50)52-30-29-46)54-45(48)32-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h35-43H,11-34,46H2,1-10H3,(H,49,50)/p-1/t37-,38-,39-,40-,41+,42+,43-/m1/s1 |
| InChIKey | XLPHMKQBBCKEFO-XCBBIQDZSA-M |
| XLogP | 11.83 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.18 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|