C46H92NO11P — CID 175266843
2-amino-3-hydroxypropanoic acid;[3-phosphonooxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate (PubChem CID 175266843) has the molecular formula C46H92NO11P and a molecular weight of 866.21 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;[3-phosphonooxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate.
| Compound Name | 2-amino-3-hydroxypropanoic acid;[3-phosphonooxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 175266843 |
| Molecular Formula | C46H92NO11P |
| Molecular Weight | 866.21 g/mol |
| Exact Mass | 865.64 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;[3-phosphonooxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)OCC(COP(=O)(O)O)OC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C.NC(CO)C(=O)O |
| InChI | InChI=1S/C43H85O8P.C3H7NO3/c1-33(2)17-11-19-35(5)21-13-23-37(7)25-15-27-39(9)29-42(44)49-31-41(32-50-52(46,47)48)51-43(45)30-40(10)28-16-26-38(8)24-14-22-36(6)20-12-18-34(3)4;4-2(1-5)3(6)7/h33-41H,11-32H2,1-10H3,(H2,46,47,48);2,5H,1,4H2,(H,6,7) |
| InChIKey | PZSFQCASTFNABD-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 202.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.21 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|