C47H96N2O11P2 — CID 91547575
[(2R)-3-[2-aminoethoxy-[2-aminoethoxy(hydroxy)phosphoryl]oxyphosphoryl]oxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate (PubChem CID 91547575) has the molecular formula C47H96N2O11P2 and a molecular weight of 927.24 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy-[2-aminoethoxy(hydroxy)phosphoryl]oxyphosphoryl]oxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy-[2-aminoethoxy(hydroxy)phosphoryl]oxyphosphoryl]oxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 91547575 |
| Molecular Formula | C47H96N2O11P2 |
| Molecular Weight | 927.24 g/mol |
| Exact Mass | 926.65 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy-[2-aminoethoxy(hydroxy)phosphoryl]oxyphosphoryl]oxy-2-(3,7,11,15-tetramethylhexadecanoyloxy)propyl] 3,7,11,15-tetramethylhexadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)OC[C@H](COP(=O)(OCCN)OP(=O)(O)OCCN)OC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C47H96N2O11P2/c1-37(2)17-11-19-39(5)21-13-23-41(7)25-15-27-43(9)33-46(50)55-35-45(36-58-62(54,57-32-30-49)60-61(52,53)56-31-29-48)59-47(51)34-44(10)28-16-26-42(8)24-14-22-40(6)20-12-18-38(3)4/h37-45H,11-36,48-49H2,1-10H3,(H,52,53)/t39?,40?,41?,42?,43?,44?,45-,62?/m1/s1 |
| InChIKey | BLHYRQIUTLRZBF-WZXHTRSISA-N |
| XLogP | 12.56 |
| TPSA | 195.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.24 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|